loading...| Preferred Name |
flavanone |
|
| Synonyms |
2-phenyl-2,3-dihydro-4H-chromen-4-one Flavanone flavanone 2-phenylchroman-4-one 2-phenyl-4-chromanone 2,3-dihydro-2-phenyl-4H-1-benzopyran-4-one 2,3-Dihydroflavone |
|
| Definitions |
The simplest member of the class of flavanones that consists of flavan bearing an oxo substituent at position 4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5070 |
|
| charge |
0 |
|
| definition |
The simplest member of the class of flavanones that consists of flavan bearing an oxo substituent at position 4. |
|
| formula |
C15H12O2 |
|
| hasDbXref |
Reaxys:85290 KEGG:C00766 Beilstein:183227 LINCS:LSM-1283 MetaCyc:FLAVANONES Beilstein:85290 CAS:487-26-3 |
|
| hasExactSynonym |
2-phenyl-2,3-dihydro-4H-chromen-4-one Flavanone flavanone |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
2-phenylchroman-4-one 2-phenyl-4-chromanone 2,3-dihydro-2-phenyl-4H-1-benzopyran-4-one 2,3-Dihydroflavone |
|
| id |
CHEBI:5070 |
|
| inchi |
InChI=1S/C15H12O2/c16-13-10-15(11-6-2-1-3-7-11)17-14-9-5-4-8-12(13)14/h1-9,15H,10H2 |
|
| inchikey |
ZONYXWQDUYMKFB-UHFFFAOYSA-N |
|
| inSubset | ||
| label |
flavanone flavanone |
|
| mass |
224.25458 |
|
| monoisotopicmass |
224.08373 |
|
| notation |
CHEBI:5070 |
|
| prefLabel |
flavanone |
|
| smiles |
O=C1CC(Oc2ccccc12)c1ccccc1 |
|
| subClassOf |