loading...| Preferred Name |
canthaxanthin |
|
| Synonyms |
canthaxanthin beta,beta-carotene-4,4'-dione Canthaxanthin Food Orange 8 Carophyll Red all-trans-beta-carotene-4,4'-dione 4,4'-dioxo-beta-carotene |
|
| Definitions |
A carotenone that consists of beta,beta-carotene bearing two oxo substituents at positions 4 and 4'. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3362 |
|
| charge |
0 |
|
| definition |
A carotenone that consists of beta,beta-carotene bearing two oxo substituents at positions 4 and 4'. |
|
| formula |
C40H52O2 |
|
| hasDbXref |
Reaxys:1898520 Wikipedia:Canthaxanthin HMDB:HMDB0003154 LIPID_MAPS_instance:LMPR01070264 PMID:22455145 PMID:22418926 KNApSAcK:C00000922 CAS:514-78-3 PMID:22353211 PMID:22366116 PMID:22451081 PMID:24097248 KEGG:C08583 Beilstein:1898520 PMID:22334741 PMID:22428120 |
|
| hasExactSynonym |
canthaxanthin beta,beta-carotene-4,4'-dione Canthaxanthin |
|
| hasOBONamespace |
chebi_ontology |
|
| hasRelatedSynonym |
Food Orange 8 Carophyll Red all-trans-beta-carotene-4,4'-dione 4,4'-dioxo-beta-carotene canthaxanthin E 161g Orobronze |
|
| id |
CHEBI:3362 |
|
| inchi |
InChI=1S/C40H52O2/c1-29(17-13-19-31(3)21-23-35-33(5)37(41)25-27-39(35,7)8)15-11-12-16-30(2)18-14-20-32(4)22-24-36-34(6)38(42)26-28-40(36,9)10/h11-24H,25-28H2,1-10H3/b12-11+,17-13+,18-14+,23-21+,24-22+,29-15+,30-16+,31-19+,32-20+ |
|
| inchikey |
FDSDTBUPSURDBL-DKLMTRRASA-N |
|
| inSubset | ||
| label |
canthaxanthin |
|
| mass |
564.83968 |
|
| monoisotopicmass |
564.39673 |
|
| notation |
CHEBI:3362 |
|
| prefLabel |
canthaxanthin |
|
| smiles |
CC(\C=C\C=C(C)\C=C\C1=C(C)C(=O)CCC1(C)C)=C/C=C/C=C(C)/C=C/C=C(C)/C=C/C1=C(C)C(=O)CCC1(C)C |
|
| subClassOf |