Preferred Name |
phloroglucinol |
|
Synonyms |
1,3,5-Trihydroxybenzene 1,3,5-Benzenetriol 1,3,5-trihydroxybenzene s-Trihydroxybenzene benzene-1,3,5-triol Phloroglucinol |
|
Definitions |
A benzenetriol with hydroxy groups at position 1, 3 and 5. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16204 |
|
charge |
0 |
|
definition |
A benzenetriol with hydroxy groups at position 1, 3 and 5. |
|
formula |
C6H6O3 |
|
hasAlternativeId |
CHEBI:11159 CHEBI:14788 CHEBI:22710 CHEBI:8114 |
|
hasDbXref |
PMID:25456733 KEGG:C02183 KEGG:D00152 UM-BBD_compID:c0026 Drug_Central:2153 PMID:25640118 Reaxys:1341907 KNApSAcK:C00002665 MetaCyc:CPD-16 Wikipedia:Phloroglucinol CAS:108-73-6 HMDB:HMDB0013675 |
|
hasExactSynonym |
Phloroglucinol benzene-1,3,5-triol |
|
hasOBONamespace |
chebi_ontology |
|
hasRelatedSynonym |
1,3,5-Trihydroxybenzene 1,3,5-Benzenetriol 1,3,5-trihydroxybenzene s-Trihydroxybenzene benzene-1,3,5-triol |
|
id |
CHEBI:16204 |
|
inchi |
InChI=1S/C6H6O3/c7-4-1-5(8)3-6(9)2-4/h1-3,7-9H |
|
inchikey |
QCDYQQDYXPDABM-UHFFFAOYSA-N |
|
inSubset | ||
label |
phloroglucinol phloroglucinol |
|
mass |
126.11004 |
|
monoisotopicmass |
126.03169 |
|
notation |
CHEBI:16204 |
|
prefLabel |
phloroglucinol |
|
smiles |
Oc1cc(O)cc(O)c1 |
|
subClassOf |