Preferred Name |
succinic acid |
|
Synonyms |
Succinic acid SUCCINIC ACID succinic acid butanedioic acid 1,2-ethanedicarboxylic acid Bernsteinsaeure HOOC-CH2-CH2-COOH Butanedionic acid acide succinique Dihydrofumaric acid Butandisaeure acide butanedioique spirit of amber Ethylenesuccinic acid acidum succinicum E363 amber acid asuccin |
|
Definitions |
An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. It is an intermediate metabolite in the citric acid cycle. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_15741 |
|
charge |
0 |
|
definition |
An alpha,omega-dicarboxylic acid resulting from the formal oxidation of each of the terminal methyl groups of butane to the corresponding carboxy group. It is an intermediate metabolite in the citric acid cycle. |
|
formula |
C4H6O4 |
|
hasAlternativeId |
CHEBI:22943 CHEBI:45639 CHEBI:26807 CHEBI:9304 |
|
hasDbXref |
Beilstein:1754069 DrugBank:DB00139 PDBeChem:SIN Gmelin:2785 LIPID_MAPS_instance:LMFA01170043 MetaCyc:SUC YMDB:YMDB00338 PMID:17439666 ECMDB:ECMDB00254 Reaxys:1754069 KEGG:C00042 KNApSAcK:C00001205 Wikipedia:Succinic_acid HMDB:HMDB0000254 Drug_Central:2487 CAS:110-15-6 |
|
hasExactSynonym |
Succinic acid SUCCINIC ACID succinic acid butanedioic acid |
|
hasOBONamespace |
chebi_ontology |
|
hasRelatedSynonym |
1,2-ethanedicarboxylic acid Bernsteinsaeure HOOC-CH2-CH2-COOH Butanedionic acid acide succinique Dihydrofumaric acid Butandisaeure acide butanedioique spirit of amber Ethylenesuccinic acid acidum succinicum E363 amber acid asuccin |
|
id |
CHEBI:15741 |
|
inchi |
InChI=1S/C4H6O4/c5-3(6)1-2-4(7)8/h1-2H2,(H,5,6)(H,7,8) |
|
inchikey |
KDYFGRWQOYBRFD-UHFFFAOYSA-N |
|
inSubset | ||
label |
succinic acid succinic acid |
|
mass |
118.08800 |
|
monoisotopicmass |
118.02661 |
|
notation |
CHEBI:15741 |
|
prefLabel |
succinic acid |
|
smiles |
OC(=O)CCC(O)=O |
|
subClassOf |