loading...| Preferred Name |
|
|
| Synonyms |
5,5-diphenylimidazolidine-2,4-dione 5,5-diphenyltetrahydro-1H-2,4-imidazoledione phenytoin fenitoina phenytoine 5,5-Diphenyl-imidazolidine-2,4-dione DILANTIN phenytoinum PHENTYTOIN |
|
| Definitions |
A imidazolidine-2,4-dione that consists of hydantoin bearing two phenyl substituents at position 5. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_8107 |
|
| charge |
0 |
|
| database_cross_reference |
KEGG COMPOUND:C07443 Beilstein:384532 ChemIDplus:57-41-0 KEGG DRUG:D00512 CiteXplore:7602118 KEGG COMPOUND:57-41-0 MeSH:D010672 SNOMEDCT:387220006 SNOMEDCT:40556005 NCIt:C741 PMID:7105825 Wikipedia:Phenytoin PMID:12952753 Patent:WO2012174723 KEGG:C07443 PMID:7602118 PMID:16303054 PMID:9186244 CAS:57-41-0 PMID:15246836 PMID:15744730 Reaxys:384532 PMID:10698828 HMDB:HMDB0014397 KEGG:D00512 DrugBank:DB00252 LINCS:LSM-5663 Drug_Central:2152 |
|
| definition |
A imidazolidine-2,4-dione that consists of hydantoin bearing two phenyl substituents at position 5. |
|
| formula |
C15H12N2O2 |
|
| has_alternative_id |
CHEBI:100921 |
|
| has_exact_synonym |
5,5-diphenylimidazolidine-2,4-dione |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
5,5-diphenyltetrahydro-1H-2,4-imidazoledione phenytoin fenitoina phenytoine 5,5-Diphenyl-imidazolidine-2,4-dione DILANTIN phenytoinum 5,5-diphenylimidazolidine-2,4-dione PHENTYTOIN |
|
| id |
CHEBI:8107 |
|
| in_subset | ||
| inchi |
InChI=1S/C15H12N2O2/c18-13-15(17-14(19)16-13,11-7-3-1-4-8-11)12-9-5-2-6-10-12/h1-10H,(H2,16,17,18,19) |
|
| inchikey |
CXOFVDLJLONNDW-UHFFFAOYSA-N |
|
| label |
phenytoin |
|
| mass |
252.26800 |
|
| monoisotopicmass |
252.08988 |
|
| notation |
CHEBI:8107 |
|
| smiles |
O=C1NC(=O)C(N1)(c1ccccc1)c1ccccc1 |
|
| subClassOf |