Preferred Name |
|
|
Synonyms |
11-cyclopropyl-4-methyl-5,11-dihydro-6H-dipyrido[3,2-b:2',3'-e][1,4]diazepin-6-one Nevirapine Viramune NEV 11-cyclopropyl-5,11-dihydro-4-methyl-6H-dipyrido(3,2-b:2',3'-e)(1,4)diazepin-6-one NVP nevirapine |
|
Definitions |
A dipyridodiazepine that is 5,11-dihydro-6H-dipyrido[3,2-b:2',3'-e][1,4]diazepine which is substituted by methyl, oxo, and cyclopropyl groups at positions 4, 6, and 11, respectively. A non-nucleoside reverse transcriptase inhibitor with activity against HIV-1, it is used in combination with other antiretrovirals for the treatment of HIV infection. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_63613 |
|
charge |
0 |
|
database_cross_reference |
SNOMEDCT:108704001 SNOMEDCT:386898005 KEGG DRUG:D00435 MeSH:D019829 Reaxys:4757598 KEGG COMPOUND:C07263 KEGG COMPOUND:129618-40-2 ChemIDplus:129618-40-2 CiteXplore:1712395 NCIt:C29277 PMID:28827836 PDBeChem:NVP PMID:28782122 PMID:1712395 PMID:28786740 CAS:129618-40-2 PMID:28835669 PMID:28819312 PMID:25017682 KEGG:D00435 KEGG:C07263 Wikipedia:Nevirapine LINCS:LSM-5336 DrugBank:DB00238 |
|
definition |
A dipyridodiazepine that is 5,11-dihydro-6H-dipyrido[3,2-b:2',3'-e][1,4]diazepine which is substituted by methyl, oxo, and cyclopropyl groups at positions 4, 6, and 11, respectively. A non-nucleoside reverse transcriptase inhibitor with activity against HIV-1, it is used in combination with other antiretrovirals for the treatment of HIV infection. |
|
formula |
C15H14N4O |
|
has_alternative_id |
CHEBI:7546 |
|
has_exact_synonym |
11-cyclopropyl-4-methyl-5,11-dihydro-6H-dipyrido[3,2-b:2',3'-e][1,4]diazepin-6-one Nevirapine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Viramune NEV 11-cyclopropyl-5,11-dihydro-4-methyl-6H-dipyrido(3,2-b:2',3'-e)(1,4)diazepin-6-one NVP nevirapine |
|
has_role | ||
id |
CHEBI:63613 |
|
in_subset | ||
inchi |
InChI=1S/C15H14N4O/c1-9-6-8-17-14-12(9)18-15(20)11-3-2-7-16-13(11)19(14)10-4-5-10/h2-3,6-8,10H,4-5H2,1H3,(H,18,20) |
|
inchikey |
NQDJXKOVJZTUJA-UHFFFAOYSA-N |
|
label |
nevirapine |
|
mass |
266.29790 |
|
monoisotopicmass |
266.11676 |
|
notation |
CHEBI:63613 |
|
smiles |
Cc1ccnc2N(C3CC3)c3ncccc3C(=O)Nc12 |
|
subClassOf |