Preferred Name |
|
|
Synonyms |
Clomipramine 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine chlorimipramine 3-chloroimipramine 3-(3-CHLORO-5H-DIBENZO[B,F]AZEPIN-5-YL)-N,N-DIMETHYLPROPAN-1-AMINE 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethyl-1-propanamine monochlorimipramine G 34586 |
|
Definitions |
A dibenzoazepine that is 10,11-dihydro-5H-dibenzo[b,f]azepine which is substituted by chlorine at position 3 and in which the hydrogen attached to the nitrogen is replaced by a 3-(dimethylamino)propyl group. One of the more sedating tricyclic antidepressants, it is used as the hydrochloride salt for the treatment of depression as well as obsessive-compulsive disorder and phobias. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_47780 |
|
charge |
0 |
|
database_cross_reference |
SNOMEDCT:96209002 ChEMBL:100996 ChemIDplus:303-49-1 CiteXplore:16085036 NCIt:C61608 MeSH:D002997 ChemIDplus:1323477 CiteXplore:17471183 SNOMEDCT:372903001 CiteXplore:12007764 CiteXplore:12084414 Reaxys:1323477 KEGG COMPOUND:303-49-1 KEGG COMPOUND:C06918 NIST Chemistry WebBook:303-49-1 CiteXplore:19810911 Drug_Central:701 PMID:17471183 Beilstein:1323477 PMID:16085036 PMID:19747949 KEGG:D07727 Wikipedia:Clomipramine LINCS:LSM-3171 Patent:US3467650 DrugBank:DB01242 PDBeChem:CXX PMID:12084414 PMID:19810911 PMID:12007764 Patent:CH371799 KEGG:C06918 CAS:303-49-1 |
|
definition |
A dibenzoazepine that is 10,11-dihydro-5H-dibenzo[b,f]azepine which is substituted by chlorine at position 3 and in which the hydrogen attached to the nitrogen is replaced by a 3-(dimethylamino)propyl group. One of the more sedating tricyclic antidepressants, it is used as the hydrochloride salt for the treatment of depression as well as obsessive-compulsive disorder and phobias. |
|
formula |
C19H23ClN2 |
|
has_alternative_id |
CHEBI:47359 CHEBI:3754 |
|
has_exact_synonym |
Clomipramine 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
chlorimipramine 3-chloroimipramine 3-(3-CHLORO-5H-DIBENZO[B,F]AZEPIN-5-YL)-N,N-DIMETHYLPROPAN-1-AMINE 3-(3-chloro-10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethyl-1-propanamine monochlorimipramine G 34586 |
|
id |
CHEBI:47780 |
|
in_subset | ||
inchi |
InChI=1S/C19H23ClN2/c1-21(2)12-5-13-22-18-7-4-3-6-15(18)8-9-16-10-11-17(20)14-19(16)22/h3-4,6-7,10-11,14H,5,8-9,12-13H2,1-2H3 |
|
inchikey |
GDLIGKIOYRNHDA-UHFFFAOYSA-N |
|
label |
clomipramine |
|
mass |
314.85210 |
|
monoisotopicmass |
314.15498 |
|
notation |
CHEBI:47780 |
|
smiles |
CN(C)CCCN1c2ccccc2CCc2ccc(Cl)cc12 |
|
subClassOf |