Preferred Name |
|
|
Synonyms |
naphthalen-1-yl methylcarbamate Carbaryl carbaryl Sevin 1-naphthol N-methylcarbamate 1-Naphthyl N-methylcarbamate N-Methyl-1-naphthyl carbamate alpha-Naphthyl N-methylcarbamate Carbaril 1-Naphthalenyl methylcarbamate 1-Naphthalenol, methylcarbamate N-Methyl-alpha-naphthylurethan |
|
Definitions |
A carbamate ester obtained by the formal condensation of 1-naphthol with methylcarbamic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3390 |
|
charge |
0 |
|
database_cross_reference |
SNOMEDCT:9021002 NCIt:C76389 MeSH:D012721 NCIt:C2803 PPDB:115 PMID:19025094 CAS:63-25-2 Reaxys:1875862 PMID:15092421 KEGG:C07491 PMID:15092693 Drug_Central:3066 LINCS:LSM-37123 KEGG:D07613 Wikipedia:Carbaryl |
|
definition |
A carbamate ester obtained by the formal condensation of 1-naphthol with methylcarbamic acid. |
|
formula |
C12H11NO2 |
|
has_exact_synonym |
naphthalen-1-yl methylcarbamate Carbaryl carbaryl |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Sevin 1-naphthol N-methylcarbamate 1-Naphthyl N-methylcarbamate N-Methyl-1-naphthyl carbamate alpha-Naphthyl N-methylcarbamate Carbaril 1-Naphthalenyl methylcarbamate 1-Naphthalenol, methylcarbamate N-Methyl-alpha-naphthylurethan |
|
has_role | ||
id |
CHEBI:3390 |
|
in_subset | ||
inchi |
InChI=1S/C12H11NO2/c1-13-12(14)15-11-8-4-6-9-5-2-3-7-10(9)11/h2-8H,1H3,(H,13,14) |
|
inchikey |
CVXBEEMKQHEXEN-UHFFFAOYSA-N |
|
label |
carbaryl |
|
mass |
201.22128 |
|
monoisotopicmass |
201.07898 |
|
notation |
CHEBI:3390 |
|
smiles |
CNC(=O)Oc1cccc2ccccc12 |
|
subClassOf |