Preferred Name |
|
|
Synonyms |
1-[(2S)-2-methyl-3-sulfanylpropanoyl]-L-proline D-3-mercapto-2-methylpropanoyl-L-proline Captoril Tensoprel Cesplon Hypertil Garranil Acepress Apopril (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid Dilabar Captopryl D-2-methyl-3-mercaptopropanoyl-L-proline L-Captopril CP Captolane captopril Tensobon captoprilum Tenosbon Capoten Lopirin |
|
Definitions |
A L-proline derivative in which L-proline is substituted on nitrogen with a (2S)-2-methyl-3-sulfanylpropanoyl group. It is used as an anti-hypertensive ACE inhibitor drug. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_3380 |
|
charge |
0 |
|
database_cross_reference |
Beilstein:477887 Drug_Central:484 PMID:23299024 PMID:23137627 PMID:23161035 CAS:62571-86-2 Patent:US4105776 PMID:23328620 KEGG:D00251 PMID:2420897 DrugBank:DB01197 PMID:23435971 Wikipedia:Captopril PMID:23397376 PMID:23429803 PMID:23422724 LINCS:LSM-5648 PMID:23410042 Patent:US4046889 PMID:23278692 |
|
definition |
A L-proline derivative in which L-proline is substituted on nitrogen with a (2S)-2-methyl-3-sulfanylpropanoyl group. It is used as an anti-hypertensive ACE inhibitor drug. |
|
formula |
C9H15NO3S |
|
has_exact_synonym |
1-[(2S)-2-methyl-3-sulfanylpropanoyl]-L-proline |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
D-3-mercapto-2-methylpropanoyl-L-proline Captoril Tensoprel Cesplon Hypertil Garranil Acepress Apopril (2S)-1-[(2S)-2-methyl-3-sulfanylpropanoyl]pyrrolidine-2-carboxylic acid Dilabar Captopryl D-2-methyl-3-mercaptopropanoyl-L-proline L-Captopril CP Captolane captopril Tensobon captoprilum Tenosbon Capoten Lopirin |
|
id |
CHEBI:3380 |
|
in_subset | ||
inchi |
InChI=1S/C9H15NO3S/c1-6(5-14)8(11)10-4-2-3-7(10)9(12)13/h6-7,14H,2-5H2,1H3,(H,12,13)/t6-,7+/m1/s1 |
|
inchikey |
FAKRSMQSSFJEIM-RQJHMYQMSA-N |
|
label |
captopril |
|
mass |
217.28500 |
|
monoisotopicmass |
217.07726 |
|
notation |
CHEBI:3380 |
|
smiles |
C[C@H](CS)C(=O)N1CCC[C@H]1C(O)=O |
|
subClassOf |