loading...| Preferred Name |
|
|
| Synonyms |
(9Z)-octadec-9-enoate cis-9-octadecenoate (Z)-9-octadecenoic acid, ion(1-) (9Z)-octadecenoate oleic acid anion Oleat |
|
| Definitions |
A C18, long straight-chain monounsaturated fatty acid anion; and the conjugate base of oleic acid, arising from deprotonation of the carboxylic acid group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30823 |
|
| charge |
-1 |
|
| database_cross_reference |
CAS:115-06-0 Gmelin:344067 PMID:12429352 Beilstein:1913148 Reaxys:1913148 |
|
| definition |
A C18, long straight-chain monounsaturated fatty acid anion; and the conjugate base of oleic acid, arising from deprotonation of the carboxylic acid group. |
|
| formula |
C18H33O2 |
|
| has_alternative_id |
CHEBI:14684 CHEBI:25663 |
|
| has_exact_synonym |
(9Z)-octadec-9-enoate |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
cis-9-octadecenoate (Z)-9-octadecenoic acid, ion(1-) (9Z)-octadecenoate oleic acid anion Oleat |
|
| id |
CHEBI:30823 |
|
| in_subset | ||
| inchi |
InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/p-1/b10-9- |
|
| inchikey |
ZQPPMHVWECSIRJ-KTKRTIGZSA-M |
|
| label |
oleate |
|
| mass |
281.45342 |
|
| monoisotopicmass |
281.24860 |
|
| notation |
CHEBI:30823 |
|
| smiles |
CCCCCCCC\C=C/CCCCCCCC([O-])=O |
|
| subClassOf |