loading...| Preferred Name |
|
|
| Synonyms |
valine DL-valine Valin valina Hval 2-amino-3-methylbutanoic acid |
|
| Definitions |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isopropyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27266 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22770225 KEGG:C16436 Wikipedia:Valine PMID:17190852 Gmelin:49877 Beilstein:506689 Reaxys:506689 CAS:516-06-3 |
|
| definition |
A branched-chain amino acid that consists of glycine in which one of the hydrogens attached to the alpha-carbon is substituted by an isopropyl group. |
|
| formula |
C5H11NO2 |
|
| has_exact_synonym |
valine |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
DL-valine Valin valina Hval 2-amino-3-methylbutanoic acid |
|
| id |
CHEBI:27266 |
|
| in_subset | ||
| inchi |
InChI=1S/C5H11NO2/c1-3(2)4(6)5(7)8/h3-4H,6H2,1-2H3,(H,7,8) |
|
| inchikey |
KZSNJWFQEVHDMF-UHFFFAOYSA-N |
|
| label |
valine |
|
| mass |
117.14638 |
|
| monoisotopicmass |
117.07898 |
|
| notation |
CHEBI:27266 |
|
| OBI_0000316 |
http://livercancer.imbi.uni-heidelberg.de/ccont#CCONT_0000002 |
|
| prefixIRI |
CHEBI:27266 |
|
| smiles |
CC(C)C(N)C(O)=O |
|
| subClassOf |