loading...| Preferred Name |
|
|
| Synonyms |
Ornithine ornithine 2,5-diaminopentanoic acid DL-Ornithine 2,5-Diaminovaleric acid 2,5-Diaminopentanoic acid Orn |
|
| Definitions |
An alpha-amino acid that is pentanoic acid bearing two amino substituents at positions 2 and 5. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_18257 |
|
| charge |
0 |
|
| database_cross_reference |
PMID:22264337 Gmelin:847696 PMID:15449570 Beilstein:1722296 CAS:616-07-9 PMID:17190852 KNApSAcK:C00001384 Reaxys:1722296 KEGG:C01602 |
|
| definition |
An alpha-amino acid that is pentanoic acid bearing two amino substituents at positions 2 and 5. |
|
| formula |
C5H12N2O2 |
|
| has_alternative_id |
CHEBI:7784 |
|
| has_exact_synonym |
Ornithine ornithine 2,5-diaminopentanoic acid |
|
| has_obo_namespace |
chebi_ontology |
|
| has_related_synonym |
DL-Ornithine 2,5-Diaminovaleric acid 2,5-Diaminopentanoic acid Orn |
|
| id |
CHEBI:18257 |
|
| in_subset | ||
| inchi |
InChI=1S/C5H12N2O2/c6-3-1-2-4(7)5(8)9/h4H,1-3,6-7H2,(H,8,9) |
|
| inchikey |
AHLPHDHHMVZTML-UHFFFAOYSA-N |
|
| label |
ornithine |
|
| mass |
132.16106 |
|
| monoisotopicmass |
132.08988 |
|
| notation |
CHEBI:18257 |
|
| smiles |
NCCCC(N)C(O)=O |
|
| subClassOf |