Preferred Name |
|
|
Synonyms |
Uracil URACIL uracil pyrimidine-2,4(1H,3H)-dione Urazil 2,4-Pyrimidinedione 2,4(1H,3H)-pyrimidinedione 2,4-Dioxopyrimidine Ura U |
|
Definitions |
A common and naturally occurring pyrimidine nucleobase in which the pyrimidine ring is substituted with two oxo groups at positions 2 and 4. Found in RNA, it base pairs with adenine and replaces thymine during DNA transcription. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17568 |
|
charge |
0 |
|
database_cross_reference |
PMID:11279060 HMDB:HMDB0000300 PMID:22074393 KEGG:D00027 PMID:18815805 Reaxys:606623 PMID:18533995 PMID:22171528 KNApSAcK:C00001513 MetaCyc:URACIL PMID:22356544 PMID:15274295 PMID:17439666 PMID:22685418 PMID:16834123 PMID:3654008 PMID:22020693 PMID:12855717 Gmelin:2896 PMID:22237209 PDBeChem:URA PMID:22299724 Beilstein:606623 Wikipedia:Uracil PMID:22567906 DrugBank:DB03419 KEGG:C00106 PMID:22483865 PMID:22120518 PMID:22447672 PMID:19175333 CAS:66-22-8 |
|
definition |
A common and naturally occurring pyrimidine nucleobase in which the pyrimidine ring is substituted with two oxo groups at positions 2 and 4. Found in RNA, it base pairs with adenine and replaces thymine during DNA transcription. |
|
formula |
C4H4N2O2 |
|
has_alternative_id |
CHEBI:46375 CHEBI:15288 CHEBI:27210 CHEBI:9882 |
|
has_exact_synonym |
Uracil URACIL uracil pyrimidine-2,4(1H,3H)-dione |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Urazil 2,4-Pyrimidinedione 2,4(1H,3H)-pyrimidinedione 2,4-Dioxopyrimidine Ura U |
|
id |
CHEBI:17568 |
|
in_subset | ||
inchi |
InChI=1S/C4H4N2O2/c7-3-1-2-5-4(8)6-3/h1-2H,(H2,5,6,7,8) |
|
inchikey |
ISAKRJDGNUQOIC-UHFFFAOYSA-N |
|
label |
uracil |
|
mass |
112.08684 |
|
monoisotopicmass |
112.02728 |
|
notation |
CHEBI:17568 |
|
smiles |
O=c1cc[nH]c(=O)[nH]1 |
|
subClassOf |