Preferred Name |
|
|
Synonyms |
Erythritol meso-erythritol erythritol Phycitol MESO-ERYTHRITOL Phycite L-erythritol erythro-tetritol Erythrol mesoerythritol Erythrite Erythrit (2R,3S)-butane-1,2,3,4-tetrol |
|
Definitions |
The meso-diastereomer of butane-1,2,3,4-tetrol. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_17113 |
|
charge |
0 |
|
database_cross_reference |
KNApSAcK:C00001161 KEGG:C00503 PMID:36615861 PMID:23421980 Gmelin:82499 PMID:22770225 CAS:149-32-6 PMID:17336832 PMID:35289142 PMID:36276829 PMID:25108762 PMID:35364613 PMID:12639570 PMID:36547619 HMDB:HMDB0002994 PMID:24643482 PMID:36478868 PMID:19632091 PMID:163226 PMID:19804861 PMID:23890177 Wikipedia:Erythritol Reaxys:1735878 PMID:9862657 PMID:16901854 MetaCyc:ERYTHRITOL PMID:18369603 PMID:35575772 PMID:36849732 PMID:17979222 Beilstein:1719753 DrugBank:DB04481 PMID:36354105 PDBeChem:MRY PMID:23574577 PMCID:PMC9193570 |
|
definition |
The meso-diastereomer of butane-1,2,3,4-tetrol. |
|
formula |
C4H10O4 |
|
has_alternative_id |
CHEBI:14215 CHEBI:23946 CHEBI:372804 CHEBI:4840 CHEBI:44263 |
|
has_exact_synonym |
Erythritol meso-erythritol erythritol |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
Phycitol MESO-ERYTHRITOL Phycite L-erythritol erythro-tetritol Erythrol mesoerythritol Erythrite Erythrit (2R,3S)-butane-1,2,3,4-tetrol |
|
id |
CHEBI:17113 |
|
in_subset | ||
inchi |
InChI=1S/C4H10O4/c5-1-3(7)4(8)2-6/h3-8H,1-2H2/t3-,4+ |
|
inchikey |
UNXHWFMMPAWVPI-ZXZARUISSA-N |
|
label |
erythritol |
|
mass |
122.11980 |
|
monoisotopicmass |
122.05791 |
|
notation |
CHEBI:17113 |
|
smiles |
OC[C@H](O)[C@H](O)CO |
|
subClassOf |