Preferred Name |
|
|
Synonyms |
(9Z)-Octadecenoic acid Oleate cis-Delta(9)-octadecenoic acid Octadec-9-enoic acid C18:1 n-9 FA 18:1 18:1Delta9cis 18:1 n-9 (Z)-Octadec-9-enoic acid Oelsaeure cis-9-octadecenoic acid cis-oleic acid OLEIC ACID (9Z)-octadec-9-enoic acid Oleic acid |
|
Definitions |
An octadec-9-enoic acid in which the double bond at C-9 has Z (cis) stereochemistry. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_16196 |
|
charge |
0 |
|
database_cross_reference |
SNOMEDCT:427281002 NCIt:C68405 MeSH:D019301 Reaxys:1726542 PMID:15325315 PDBeChem:OLA KNApSAcK:C00001232 Wikipedia:Oleic_acid PMID:24819471 PMID:6205897 PMID:5332408 DrugBank:DB04224 CAS:112-80-1 Gmelin:57556 Beilstein:1726542 PMID:23844805 PMID:19761868 PMID:18772370 KEGG:C00712 Gmelin:109551 LIPID_MAPS_instance:LMFA01030002 ECMDB:ECMDB21348 KEGG:D02315 PMID:15723125 Drug_Central:3400 PMID:25584012 PMID:11304127 HMDB:HMDB0000207 PMID:25794012 |
|
definition |
An octadec-9-enoic acid in which the double bond at C-9 has Z (cis) stereochemistry. |
|
formula |
C18H34O2 |
|
has_alternative_id |
CHEBI:104361 CHEBI:7741 CHEBI:25664 CHEBI:44741 |
|
has_exact_synonym |
OLEIC ACID (9Z)-octadec-9-enoic acid Oleic acid |
|
has_obo_namespace |
chebi_ontology |
|
has_related_synonym |
(9Z)-Octadecenoic acid Oleate cis-Delta(9)-octadecenoic acid Octadec-9-enoic acid C18:1 n-9 FA 18:1 18:1Delta9cis 18:1 n-9 (Z)-Octadec-9-enoic acid Oelsaeure cis-9-octadecenoic acid cis-oleic acid |
|
id |
CHEBI:16196 |
|
in_subset | ||
inchi |
InChI=1S/C18H34O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h9-10H,2-8,11-17H2,1H3,(H,19,20)/b10-9- |
|
inchikey |
ZQPPMHVWECSIRJ-KTKRTIGZSA-N |
|
label |
oleic acid |
|
mass |
282.46140 |
|
monoisotopicmass |
282.25588 |
|
notation |
CHEBI:16196 |
|
smiles |
CCCCCCCC\C=C/CCCCCCCC(O)=O |
|
subClassOf |