Jump to:
loading...| Preferred Name |
sulfadoxine |
|
| Synonyms |
|
|
| Definitions |
A pyrimidine compound having methoxy substituents at the 5- and 6-positions and a 4-aminobenzenesulfonamido group at the 4-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9329 |
|
| alternative term |
sulfadoxine InChI=1S/C12H14N4O4S/c1-19-10-11(14-7-15-12(10)20-2)16-21(17,18)9-5-3-8(13)4-6-9/h3-7H,13H2,1-2H3,(H,14,15,16) Sulfadoxine Sulphadoxine Sulforthomidine COc1ncnc(NS(=O)(=O)c2ccc(N)cc2)c1OC C12H14N4O4S InChIKey=PJSFRIWCGOHTNF-UHFFFAOYSA-N sulfadoxinum sulfadoxina 4-amino-N-(5,6-dimethoxypyrimidin-4-yl)benzenesulfonamide 4-Sulfanilamido-5,6-dimethoxypyrimidine Sulphormethoxine |
|
| definition |
A pyrimidine compound having methoxy substituents at the 5- and 6-positions and a 4-aminobenzenesulfonamido group at the 4-position. |
|
| has role | ||
| label |
sulfadoxine |
|
| prefixIRI |
CHEBI:9329 |
|
| prefLabel |
sulfadoxine |
|
| subClassOf |
Create mapping