Jump to:
loading...| Preferred Name |
atovaquone |
|
| Synonyms |
|
|
| Definitions |
A naphthoquinone compound having a 4-(4-chlorophenyl)cyclohexyl group at the 2-position and a hydroxy substituent at the 3-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_575568 |
|
| alternative term |
InChI=1S/C22H19ClO3/c23-16-11-9-14(10-12-16)13-5-7-15(8-6-13)19-20(24)17-3-1-2-4-18(17)21(25)22(19)26/h1-4,9-13,15,26H,5-8H2/t13-,15- OC1=C([C@H]2CC[C@@H](CC2)c2ccc(Cl)cc2)C(=O)c2ccccc2C1=O C22H19ClO3 2-[trans-4-(4-chlorophenyl)cyclohexyl]-3-hydroxy-1,4-naphthoquinone atovaquone 2-(trans-4-(p-Chlorophenyl)cyclohexyl)-3-hydroxy-1,4-naphthoquinone InChIKey=KUCQYCKVKVOKAY-CTYIDZIISA-N |
|
| definition |
A naphthoquinone compound having a 4-(4-chlorophenyl)cyclohexyl group at the 2-position and a hydroxy substituent at the 3-position. |
|
| has role | ||
| label |
atovaquone |
|
| prefixIRI |
CHEBI:575568 |
|
| prefLabel |
atovaquone |
|
| subClassOf |
Create mapping