loading...| Preferred Name |
heptanoic acid |
|
| Synonyms |
|
|
| Definitions |
A C7, straight-chain fatty acid that contributes to the odour of some rancid oils. Used in the preparation of esters for the fragrance industry, and as an additive in cigarettes. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_45571 |
|
| alternative term |
oenanthylic acid oenanthic acid InChIKey=MNWFXJYAOYHMED-UHFFFAOYSA-N Heptansaeure enanthylic acid CCCCCCC(O)=O Oenanthsaeure heptanoic acid C7H14O2 n-heptoic acid n-heptylic acid CH3-[CH2]5-COOH n-heptanoic acid heptylic acid enanthic acid heptoic acid HEPTANOIC ACID InChI=1S/C7H14O2/c1-2-3-4-5-6-7(8)9/h2-6H2,1H3,(H,8,9) |
|
| definition |
A C7, straight-chain fatty acid that contributes to the odour of some rancid oils. Used in the preparation of esters for the fragrance industry, and as an additive in cigarettes. |
|
| is conjugate acid of | ||
| label |
heptanoic acid |
|
| prefixIRI |
CHEBI:45571 |
|
| prefLabel |
heptanoic acid |
|
| subClassOf |