loading...| Preferred Name |
cyclizine |
|
| Synonyms |
|
|
| Definitions |
An N-alkylpiperazine in which one nitrogen of the piperazine ring is substituted by a methyl group, while the other is substituted by a diphenylmethyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3994 |
|
| alternative term |
cyclizine N-methyl-N'-benzhydrylpiperazine 1-Benzhydryl-4-methylpiperazin N-Benzhydryl-N'-methylpiperazine 1-(Diphenylmethyl)-4-methylpiperazine InChI=1S/C18H22N2/c1-19-12-14-20(15-13-19)18(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-11,18H,12-15H2,1H3 cyclizinum C18H22N2 (N-Benzhydryl)(N'-methyl)diethylenediamine InChIKey=UVKZSORBKUEBAZ-UHFFFAOYSA-N ciclizina (+-)-1-diphenylmethyl-4-methylpiperazine Cyclizine 1-(diphenylmethyl)-4-methylpiperazine CN1CCN(CC1)C(c1ccccc1)c1ccccc1 |
|
| definition |
An N-alkylpiperazine in which one nitrogen of the piperazine ring is substituted by a methyl group, while the other is substituted by a diphenylmethyl group. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_48873 http://purl.obolibrary.org/obo/CHEBI_36333 |
|
| label |
cyclizine |
|
| prefixIRI |
CHEBI:3994 |
|
| prefLabel |
cyclizine |
|
| subClassOf |