loading...| Preferred Name |
clorazepic acid |
|
| Synonyms |
|
|
| Definitions |
A 1,4-benzodiazepinone in which the oxo group is at position 2, and which is substituted at positions 3, 5, and 7 by carboxy, phenyl and chloro groups, respectively. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3761 |
|
| alternative term |
InChIKey=XDDJGVMJFWAHJX-UHFFFAOYSA-N C16H11ClN2O3 InChI=1S/C16H11ClN2O3/c17-10-6-7-12-11(8-10)13(9-4-2-1-3-5-9)19-14(16(21)22)15(20)18-12/h1-8,14H,(H,18,20)(H,21,22) OC(=O)C1N=C(c2ccccc2)c2cc(Cl)ccc2NC1=O 7-chloro-2-oxo-5-phenyl-2,3-dihydro-1H-1,4-benzodiazepine-3-carboxylic acid 7-chloro-2,3-dihydro-2,2-dihydroxy-5-phenyl-1H-1,4-benzodiazepine-3-carboxylic acid Clorazepate |
|
| definition |
A 1,4-benzodiazepinone in which the oxo group is at position 2, and which is substituted at positions 3, 5, and 7 by carboxy, phenyl and chloro groups, respectively. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_50268 http://purl.obolibrary.org/obo/CHEBI_35474 |
|
| is conjugate acid of | ||
| label |
clorazepic acid |
|
| prefixIRI |
CHEBI:3761 |
|
| prefLabel |
clorazepic acid |
|
| subClassOf |