Preferred Name |
dichloroacetic acid |
|
Synonyms |
|
|
Definitions |
An organochlorine compound comprising acetic acid carrying two chloro substituents at the 2-position. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_36386 |
|
alternative term |
InChIKey=JXTHNDFMNIQAHM-UHFFFAOYSA-N 2,2-dichloroacetic acid bichloracetic acid DICHLORO-ACETIC ACID dichloroacetic acid C2H2Cl2O2 Dichloroacetate InChI=1S/C2H2Cl2O2/c3-1(4)2(5)6/h1H,(H,5,6) OC(=O)C(Cl)Cl dichloracetic acid Dichloressigsaeure |
|
definition |
An organochlorine compound comprising acetic acid carrying two chloro substituents at the 2-position. |
|
has functional parent | ||
is conjugate acid of | ||
label |
dichloroacetic acid |
|
prefixIRI |
CHEBI:36386 |
|
prefLabel |
dichloroacetic acid |
|
subClassOf |
Create mapping