Jump to:
loading...| Preferred Name |
sodium acetate |
|
| Synonyms |
|
|
| Definitions |
An organic sodium salt that has formula C2H3NaO2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_32954 |
|
| alternative term |
sodium acetate InChIKey=VMHLLURERBWHNL-UHFFFAOYSA-M InChI=1S/C2H4O2.Na/c1-2(3)4;/h1H3,(H,3,4);/q;+1/p-1 sodium acetate anhydrous Natriumazetat acetic acid, sodium salt [Na+].CC([O-])=O C2H3NaO2 anhydrous sodium acetate |
|
| definition |
An organic sodium salt that has formula C2H3NaO2. |
|
| label |
sodium acetate |
|
| prefixIRI |
CHEBI:32954 |
|
| prefLabel |
sodium acetate |
|
| subClassOf |
Create mapping