loading...| Preferred Name |
lauric acid |
|
| Synonyms |
|
|
| Definitions |
A straight-chain, twelve-carbon medium-chain saturated fatty acid with strong bactericidal properties; the main fatty acid in coconut oil and palm kernel oil. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_30805 |
|
| alternative term |
1-undecanecarboxylic acid C12 fatty acid LAURIC ACID Laurinsaeure InChI=1S/C12H24O2/c1-2-3-4-5-6-7-8-9-10-11-12(13)14/h2-11H2,1H3,(H,13,14) Duodecyclic acid N-dodecanoic acid n-dodecanoic acid Coconut oil fatty acids C12H24O2 dodecoic acid InChIKey=POULHZVOKOAJMA-UHFFFAOYSA-N Duodecylic acid dodecanoic acid Dodecylic acid Laurostearic acid CCCCCCCCCCCC(O)=O ABL CH3-[CH2]10-COOH DAO C12:0 Vulvic acid Undecane-1-carboxylic acid Dodecanoic acid Lauric acid |
|
| definition |
A straight-chain, twelve-carbon medium-chain saturated fatty acid with strong bactericidal properties; the main fatty acid in coconut oil and palm kernel oil. |
|
| has parent hydride | ||
| is conjugate acid of | ||
| label |
lauric acid |
|
| prefixIRI |
CHEBI:30805 |
|
| prefLabel |
lauric acid |
|
| subClassOf |