Preferred Name |
phenylacetic acid |
|
Synonyms |
|
|
Definitions |
Benzene to which is attached a carboxymethyl functional group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_30745 |
|
alternative term |
Benzylformic acid InChIKey=WLJVXDMOQOGPHL-UHFFFAOYSA-N benzeneacetic acid 2-PHENYLACETIC ACID phenylacetic acid alpha-toluic acid InChI=1S/C8H8O2/c9-8(10)6-7-4-2-1-3-5-7/h1-5H,6H2,(H,9,10) C8H8O2 PA OC(=O)Cc1ccccc1 Phenylacetic acid 2-phenylethanoic acid |
|
definition |
Benzene to which is attached a carboxymethyl functional group. |
|
has functional parent | ||
has role | ||
is conjugate acid of | ||
label |
phenylacetic acid |
|
prefixIRI |
CHEBI:30745 |
|
prefLabel |
phenylacetic acid |
|
subClassOf |
Create mapping