Jump to:
loading...| Preferred Name |
ethyl acetate |
|
| Synonyms |
|
|
| Definitions |
The ethyl ester of acetic acid. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_27750 |
|
| alternative term |
Essigester InChI=1S/C4H8O2/c1-3-6-4(2)5/h3H2,1-2H3 acetic ester CH3-CO-O-CH3 Ethyl acetate ethyl acetic ester CCOC(C)=O ETHYL ACETATE ethyl ethanoate acetoxyethane Ethylazetat vinegar naphtha InChIKey=XEKOWRVHYACXOJ-UHFFFAOYSA-N Essigsaeureethylester acetic acid ethyl ester Ethylacetat ethyl acetate 1-acetoxyethane acetic acid, ethyl ester C4H8O2 |
|
| definition |
The ethyl ester of acetic acid. |
|
| has role | ||
| label |
ethyl acetate |
|
| prefixIRI |
CHEBI:27750 |
|
| prefLabel |
ethyl acetate |
|
| subClassOf |
Create mapping