Preferred Name |
anagrelide |
|
Synonyms |
|
|
Definitions |
A 1,5-dihydroimidazo[2,1-]quinazoline having an oxo substituent at the 2-position and chloro substituents at the 6- and 7-positions. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_142290 |
|
alternative term |
anagrelide InChI=1S/C10H7Cl2N3O/c11-6-1-2-7-5(9(6)12)3-15-4-8(16)14-10(15)13-7/h1-2H,3-4H2,(H,13,14,16) InChIKey=OTBXOEAOVRKTNQ-UHFFFAOYSA-N anagrelida 6,7-dichloro-1,5-dihydroimidazo[2,1-]quinazolin-2(3H)-one anagrelidum C10H7Cl2N3O Clc1ccc2N=C3NC(=O)CN3Cc2c1Cl |
|
definition |
A 1,5-dihydroimidazo[2,1-]quinazoline having an oxo substituent at the 2-position and chloro substituents at the 6- and 7-positions. |
|
has role |
http://purl.obolibrary.org/obo/CHEBI_50249 http://purl.obolibrary.org/obo/CHEBI_48675 |
|
label |
anagrelide |
|
prefixIRI |
CHEBI:142290 |
|
prefLabel |
anagrelide |
|
subClassOf |
Create mapping