Preferred Name |
acetylsalicylate |
|
Synonyms |
|
|
Definitions |
A benzoate that is the conjugate base of acetylsalicylic acid, arising from deprotonation of the carboxy group. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_13719 |
|
alternative term |
InChI=1S/C9H8O4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3,(H,11,12)/p-1 InChIKey=BSYNRYMUTXBXSQ-UHFFFAOYSA-M CC(=O)Oc1ccccc1C([O-])=O C9H7O4 2-(acetyloxy)benzoate |
|
definition |
A benzoate that is the conjugate base of acetylsalicylic acid, arising from deprotonation of the carboxy group. |
|
has functional parent | ||
is conjugate base of | ||
label |
acetylsalicylate |
|
prefixIRI |
CHEBI:13719 |
|
prefLabel |
acetylsalicylate |
|
subClassOf |
Create mapping