loading...| Preferred Name |
anisindione |
|
| Synonyms |
|
|
| Definitions |
A cyclic diketone consisting of indane-1,3-dione having a 4-methoxyphenyl substituent at the 4-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_133809 |
|
| alternative term |
2-(4-Methoxyphenyl)-1H-indene-1,3(2H)-dione InChI=1S/C16H12O3/c1-19-11-8-6-10(7-9-11)14-15(17)12-4-2-3-5-13(12)16(14)18/h2-9,14H,1H3 anisindionum 2-(4-Methoxyphenyl)indan-1,3-dione 2-para-Anisyl-1,3-indandione Anisin indandione 2-(p-Methoxyphenyl)-1,3-indandione COc1ccc(cc1)C1C(=O)c2ccccc2C1=O InChIKey=XRCFXMGQEVUZFC-UHFFFAOYSA-N 2-p-Anisyl-1,3-indandione C16H12O3 2-(p-Methoxyphenyl)indane-1,3-dione 2-(4-methoxyphenyl)-1H-indene-1,3(2H)-dione anisindione anisindiona |
|
| definition |
A cyclic diketone consisting of indane-1,3-dione having a 4-methoxyphenyl substituent at the 4-position. |
|
| has parent hydride | ||
| has role | ||
| label |
anisindione |
|
| prefixIRI |
CHEBI:133809 |
|
| prefLabel |
anisindione |
|
| subClassOf |