Jump to:
loading...| Preferred Name |
warfarin sodium |
|
| Synonyms |
|
|
| Definitions |
An organic sodium salt that has formula C19H15NaO4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_10034 |
|
| alternative term |
InChIKey=KYITYFHKDODNCQ-UHFFFAOYSA-M Jantoven Sodium coumadin Coumadin InChI=1S/C19H16O4.Na/c1-12(20)11-15(13-7-3-2-4-8-13)17-18(21)14-9-5-6-10-16(14)23-19(17)22;/h2-10,15,21H,11H2,1H3;/q;+1/p-1 Maveran 3-(alpha-Acetonylbenzyl)-4-hydroxycoumarin sodium salt (+-)-Warfarin sodium [Na+].CC(=O)CC(c1ccccc1)c1c([O-])c2ccccc2oc1=O C19H15O4.Na sodium 2-oxo-3-(3-oxo-1-phenylbutyl)-2H-benzopyran-4-olate Sodium warfarin C19H15NaO4 |
|
| definition |
An organic sodium salt that has formula C19H15NaO4. |
|
| has part | ||
| label |
warfarin sodium |
|
| prefixIRI |
CHEBI:10034 |
|
| prefLabel |
warfarin sodium |
|
| subClassOf |
Create mapping