loading...| Preferred Name |
thimerosal |
|
| Synonyms |
|
|
| Definitions |
An organomercury compound (approximately 49% mercury by weight) used as an antiseptic and antifungal agent. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_9546 |
|
| alternative term |
o-(ethylmercurithio)benzoic acid sodium salt ethyl(2-mercaptobenzoato-S)mercury sodium salt thiomersalate sodium ethylmercurithiosalicylate Thimerosal [Na+].CC[Hg]Sc1ccccc1C([O-])=O InChI=1S/C7H6O2S.C2H5.Hg.Na/c8-7(9)5-3-1-2-4-6(5)10;1-2;;/h1-4,10H,(H,8,9);1H2,2H3;;/q;;2*+1/p-2 sodium [(2-carboxylatophenyl)sulfanyl](ethyl)mercurate(1-) InChIKey=RTKIYNMVFMVABJ-UHFFFAOYSA-L sodium ethyl[2-(sulfanyl-kappaS)benzoato(2-)]mercurate(1-) C9H9HgO2S.Na [(o-carboxyphenyl)thio]ethylmercury sodium salt Thiomersal Merthiolate mercurothiolate ethylmercurithiosalicylate sodium C9H9HgNaO2S |
|
| definition |
An organomercury compound (approximately 49% mercury by weight) used as an antiseptic and antifungal agent. |
|
| has part | ||
| has role | ||
| label |
thimerosal |
|
| prefixIRI |
CHEBI:9546 |
|
| prefLabel |
thimerosal |
|
| subClassOf |