Jump to:
loading...| Preferred Name |
calcium oxalate |
|
| Synonyms |
|
|
| Definitions |
The calcium salt of oxalic acid, which in excess in the urine may lead to formation of oxalate calculi (kidney stones). |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_60579 |
|
| alternative term |
C2CaO4 InChIKey=QXDMQSPYEZFLGF-UHFFFAOYSA-L calcium oxalate [Ca++].[O-]C(=O)C([O-])=O InChI=1S/C2H2O4.Ca/c3-1(4)2(5)6;/h(H,3,4)(H,5,6);/q;+2/p-2 |
|
| definition |
The calcium salt of oxalic acid, which in excess in the urine may lead to formation of oxalate calculi (kidney stones). |
|
| has part | ||
| label |
calcium oxalate |
|
| prefixIRI |
CHEBI:60579 |
|
| prefLabel |
calcium oxalate |
|
| subClassOf |
Create mapping