loading...| Preferred Name |
quaternium-15 |
|
| Synonyms |
|
|
| Definitions |
A quaternary ammonium salt derived from hexamethylenetetramine; used as a preservative in many cosmetics and industrial substances. Also acts as a disinfectant and allergenic agent. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_59607 |
|
| alternative term |
N-(3-Chloroallyl)hexaminium chloride InChI=1S/C9H16ClN4.ClH/c10-2-1-3-14-7-11-4-12(8-14)6-13(5-11)9-14;/h1-2H,3-9H2;1H/q+1;/p-1 1-[3-chloroprop-2-en-1-yl]-3,5,7-triaza-1-azoniatricyclo[3.3.1.1(3),(7)]decane chloride 1-(3-chloro-2-propenyl)-3,5,7-triaza-1-azoniatricyclo(3.3.1.13,7)decane chloride 1-(3-Chloroallyl)-3,5,7-triaza-1-azoniaadamantane chloride [Cl-].[H]C(Cl)=C([H])C[N+]12CN3CN(CN(C3)C1)C2 Hexamethylenetetramine chloroallyl chloride Methenamine 3-chloroallylochloride InChIKey=UKHVLWKBNNSRRR-UHFFFAOYSA-M C9H16Cl2N4 |
|
| definition |
A quaternary ammonium salt derived from hexamethylenetetramine; used as a preservative in many cosmetics and industrial substances. Also acts as a disinfectant and allergenic agent. |
|
| has functional parent | ||
| has role |
http://purl.obolibrary.org/obo/CHEBI_33282 http://purl.obolibrary.org/obo/CHEBI_59174 |
|
| label |
quaternium-15 |
|
| prefixIRI |
CHEBI:59607 |
|
| prefLabel |
quaternium-15 |
|
| subClassOf |