Jump to:
loading...| Preferred Name |
imipramine hydrochloride |
|
| Synonyms |
|
|
| Definitions |
A tricyclic antidepressant that has formula C19H24N2.HCl. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_5882 |
|
| alternative term |
InChIKey=XZZXIYZZBJDEEP-UHFFFAOYSA-N C19H24N2.HCl Antideprin hydrochloride 3-(10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-aminium chloride C19H25ClN2 Imipramine hydrochloride [Cl-].[H][N+](C)(C)CCCN1c2ccccc2CCc2ccccc12 Tofranil 3-(10,11-dihydro-5H-dibenzo[b,f]azepin-5-yl)-N,N-dimethylpropan-1-amine hydrochloride InChI=1S/C19H24N2.ClH/c1-20(2)14-7-15-21-18-10-5-3-8-16(18)12-13-17-9-4-6-11-19(17)21;/h3-6,8-11H,7,12-15H2,1-2H3;1H |
|
| definition |
A tricyclic antidepressant that has formula C19H24N2.HCl. |
|
| has part | ||
| label |
imipramine hydrochloride |
|
| prefixIRI |
CHEBI:5882 |
|
| prefLabel |
imipramine hydrochloride |
|
| subClassOf |
Create mapping