loading...| Preferred Name |
aceprometazine |
|
| Synonyms |
|
|
| Definitions |
A phenothiazine compound having an acetyl group at the 2-position and a 2-(dimethylamino)-1-propyl group at the 10-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_53770 |
|
| alternative term |
1-{10-[2-(dimethylamino)propyl]-10H-phenothiazin-2-yl}ethanone Acepromethazine InChI=1S/C19H22N2OS/c1-13(20(3)4)12-21-16-7-5-6-8-18(16)23-19-10-9-15(14(2)22)11-17(19)21/h5-11,13H,12H2,1-4H3 aceprometazinum 10-(2-(Dimethylamino)propyl)phenothiazin-2-yl methyl ketone aceprometazine C19H22N2OS CC(CN1c2ccccc2Sc2ccc(cc12)C(C)=O)N(C)C InChIKey=XLOQNFNTQIRSOX-UHFFFAOYSA-N aceprometazina |
|
| definition |
A phenothiazine compound having an acetyl group at the 2-position and a 2-(dimethylamino)-1-propyl group at the 10-position. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_37956 |
|
| label |
aceprometazine |
|
| prefixIRI |
CHEBI:53770 |
|
| prefLabel |
aceprometazine |
|
| subClassOf |