Preferred Name |
potassium dichromate |
|
Synonyms |
|
|
Definitions |
The dipotassium salt of dichromic acid. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_53444 |
|
alternative term |
Potassium dichromate(VI) potassium dichromate(VI) InChI=1S/2Cr.2K.7O/q;;2*+1;;;;;;2*-1 Dichromic acid dipotassium salt Dipotassium bichromate Kaliumdichromat Dipotassium dichromate dipotassium dichromate potassium dichromate(2-) [K+].[K+].[O-][Cr](=O)(=O)O[Cr]([O-])(=O)=O Dipotassium dichromium heptaoxide InChIKey=KMUONIBRACKNSN-UHFFFAOYSA-N Cr2K2O7 Chromium potassium oxide |
|
definition |
The dipotassium salt of dichromic acid. |
|
has part | ||
label |
potassium dichromate |
|
prefixIRI |
CHEBI:53444 |
|
prefLabel |
potassium dichromate |
|
subClassOf |
Create mapping