Jump to:
loading...| Preferred Name |
butane-1,3-diol |
|
| Synonyms |
|
|
| Definitions |
A butanediol compound having two hydroxy groups in the 1- and 3-positions. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_52683 |
|
| alternative term |
Methyltrimethylene glycol butane-1,3-diol Butane-1,3-diol (RS)-1,3-Butandiol 1,3-Butylene glycol 1,3-Butanediol 1,3-Dihydroxybutane 1,3 Butylene glycol 1-Methyl-1,3-propanediol 1,3-Butandiol beta-Butylene glycol 1,3-Butylenglykol InChI=1S/C4H10O2/c1-4(6)2-3-5/h4-6H,2-3H2,1H3 C4H10O2 InChIKey=PUPZLCDOIYMWBV-UHFFFAOYSA-N CC(O)CCO |
|
| definition |
A butanediol compound having two hydroxy groups in the 1- and 3-positions. |
|
| has parent hydride | ||
| label |
butane-1,3-diol |
|
| prefixIRI |
CHEBI:52683 |
|
| prefLabel |
butane-1,3-diol |
|
| subClassOf |
Create mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_52683 | PDRO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_52683 | CHEBI | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_52683 | BERO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_52683 | DRON | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_52683 | PDRO | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_52683 | CHEBI | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_52683 | BERO | LOOM |