Preferred Name |
lysophosphatidic acid |
|
Synonyms |
|
|
Definitions |
LPA is a phospholipid derivative that acts as a potent signaling molecule. LPA acts as a potent mitogen due to its activation of three high-affinity GPCRs. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_52288 |
|
alternative term |
2-hydroxy-3-(phosphonooxy)propyl octadec-9-enoate InChI=1S/C21H41O7P/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-21(23)27-18-20(22)19-28-29(24,25)26/h9-10,20,22H,2-8,11-19H2,1H3,(H2,24,25,26) InChIKey=WRGQSWVCFNIUNZ-UHFFFAOYSA-N C21H41O7P [H]C(CCCCCCCC)=C([H])CCCCCCCC(=O)OCC(O)COP(O)(O)=O LPA |
|
definition |
LPA is a phospholipid derivative that acts as a potent signaling molecule. LPA acts as a potent mitogen due to its activation of three high-affinity GPCRs. |
|
has role | ||
label |
lysophosphatidic acid |
|
prefixIRI |
CHEBI:52288 |
|
prefLabel |
lysophosphatidic acid |
|
subClassOf |
Create mapping