Jump to:
loading...| Preferred Name |
rose bengal |
|
| Synonyms |
|
|
| Definitions |
An organic potassium salt that has formula C20H2Cl4I4K2O5. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_52261 |
|
| alternative term |
Rose bengale C20H2Cl4I4K2O5 Bengal rose InChI=1S/C20H4Cl4I4O5.2K/c21-10-8(9(20(31)32)11(22)13(24)12(10)23)7-3-1-5(25)16(29)14(27)18(3)33-19-4(7)2-6(26)17(30)15(19)28;;/h1-2,29H,(H,31,32);;/q;2*+1/p-2 Red No. 105 InChIKey=AZJPTIGZZTZIDR-UHFFFAOYSA-L [K+].[K+].[O-]C(=O)c1c(Cl)c(Cl)c(Cl)c(Cl)c1-c1c2cc(I)c([O-])c(I)c2oc2c(I)c(=O)c(I)cc12 dipotassium 2,3,4,5-tetrachloro-6-(2,4,5,7-tetraiodo-6-oxido-3-oxo-3H-xanthen-9-yl)benzoate |
|
| definition |
An organic potassium salt that has formula C20H2Cl4I4K2O5. |
|
| has functional parent | ||
| has part | ||
| has role | ||
| label |
rose bengal |
|
| prefixIRI |
CHEBI:52261 |
|
| prefLabel |
rose bengal |
|
| subClassOf |
Create mapping