Jump to:
loading...| Preferred Name |
oxacillin sodium |
|
| Synonyms |
|
|
| Definitions |
An organic sodium salt that has formula C19H18N3NaO5S. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_52134 |
|
| alternative term |
oxacillin sodium salt [Na+].[H][C@]12SC(C)(C)[C@@H](N1C(=O)[C@H]2NC(=O)c1c(C)onc1-c1ccccc1)C([O-])=O InChIKey=VDUVBBMAXXHEQP-SLINCCQESA-M InChI=1S/C19H19N3O5S.Na/c1-9-11(12(21-27-9)10-7-5-4-6-8-10)15(23)20-13-16(24)22-14(18(25)26)19(2,3)28-17(13)22;/h4-8,13-14,17H,1-3H3,(H,20,23)(H,25,26);/q;+1/p-1/t13-,14+,17-;/m1./s1 sodium 6beta-(5-methyl-3-phenylisoxazol-4-yl)penicillanate sodium 2,2-dimethyl-6beta-(5-methyl-3-phenyl-1,2-oxazole-4-carboxamido)penam-3alpha-carboxylate C19H18N3NaO5S |
|
| definition |
An organic sodium salt that has formula C19H18N3NaO5S. |
|
| has part | ||
| label |
oxacillin sodium |
|
| prefixIRI |
CHEBI:52134 |
|
| prefLabel |
oxacillin sodium |
|
| subClassOf |
Create mapping