loading...| Preferred Name |
amphetamine sulfate |
|
| Synonyms |
|
|
| Definitions |
An organic sulfate salt that has formula (C9H13N)2.H2SO4. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_51063 |
|
| alternative term |
InChIKey=PYHRZPFZZDCOPH-UHFFFAOYSA-N DL-1-Phenyl-2-aminopropane sulfate InChI=1S/2C9H13N.H2O4S/c2*1-8(10)7-9-5-3-2-4-6-9;1-5(2,3)4/h2*2-6,8H,7,10H2,1H3;(H2,1,2,3,4) OS(O)(=O)=O.CC(N)Cc1ccccc1.CC(N)Cc1ccccc1 (+-)-alpha-Methylphenethylamine sulfate (2:1) DL-Amphetamine hydrogen sulfate Desoxynorephedrine sulfate Amphamine sulfate bis{1-phenylpropan-2-amine} sulfate Amphetamine sulphate dl-Phenamine sulfate (+-)-2-Amino-1-phenylpropane sulfate Amphetamine sulfate (+-)-Phenisopropylamine sulfate phenaminum Amphetamini sulfas Amphetaminium sulfuricum (C9H13N)2.H2SO4 (+-)-Amphetamine sulfate |
|
| definition |
An organic sulfate salt that has formula (C9H13N)2.H2SO4. |
|
| has part | ||
| label |
amphetamine sulfate |
|
| prefixIRI |
CHEBI:51063 |
|
| prefLabel |
amphetamine sulfate |
|
| subClassOf |