Preferred Name |
cyclizine hydrochloride |
|
Synonyms |
|
|
Definitions |
A hydrochloride salt consisting of equimolar amount s of cyclizine and hydrogen chloride. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_51045 |
|
alternative term |
C18H22N2.HCl cyclizine monohydrochloride C18H23ClN2 InChI=1S/C18H22N2.ClH/c1-19-12-14-20(15-13-19)18(16-8-4-2-5-9-16)17-10-6-3-7-11-17;/h2-11,18H,12-15H2,1H3;1H 1-(Diphenylmethyl)-4-methylpiperazine monohydrochloride InChIKey=UKPBEPCQTDRZSE-UHFFFAOYSA-N Cl.CN1CCN(CC1)C(c1ccccc1)c1ccccc1 Cyclizine HCl 1-(diphenylmethyl)-4-methylpiperazine hydrochloride Valoid (+-)-1-diphenylmethyl-4-methylpiperazine hydrochloride |
|
definition |
A hydrochloride salt consisting of equimolar amount s of cyclizine and hydrogen chloride. |
|
has part | ||
has role |
http://purl.obolibrary.org/obo/CHEBI_37955 http://purl.obolibrary.org/obo/CHEBI_48873 |
|
label |
cyclizine hydrochloride |
|
prefixIRI |
CHEBI:51045 |
|
prefLabel |
cyclizine hydrochloride |
|
subClassOf |