Jump to:
loading...| Preferred Name |
arsenous acid |
|
| Synonyms |
|
|
| Definitions |
An arsenic oxoacid that has formula AsH3O3. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_49900 |
|
| alternative term |
arsenous acid InChI=1S/AsH3O3/c2-1(3)4/h2-4H [As(OH)3] AsH3O3 trihydrogen trioxoarsenate(3-) InChIKey=GCPXMJHSNVMWNM-UHFFFAOYSA-N TRIHYDROXYARSENITE(III) H3AsO3 arsorous acid trihydroxidoarsenic As(OH)3 trioxoarsenic acid O[As](O)O |
|
| definition |
An arsenic oxoacid that has formula AsH3O3. |
|
| is conjugate acid of | ||
| label |
arsenous acid |
|
| prefixIRI |
CHEBI:49900 |
|
| prefLabel |
arsenous acid |
|
| subClassOf |
Create mapping