Jump to:
loading...| Preferred Name |
O-methyleugenol |
|
| Synonyms |
|
|
| Definitions |
A phenylpropanoid that has formula C11H14O2. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_4918 |
|
| alternative term |
C11H14O2 InChI=1S/C11H14O2/c1-4-5-9-6-7-10(12-2)11(8-9)13-3/h4,6-8H,1,5H2,2-3H3 Methyl eugenol 1,2-Dimethoxy-4-(2-propenyl)benzene O-Methyleugenol 1,2-dimethoxy-4-(prop-2-en-1-yl)benzene COc1ccc(CC=C)cc1OC Methyleugenol Eugenol methyl ether InChIKey=ZYEMGPIYFIJGTP-UHFFFAOYSA-N |
|
| definition |
A phenylpropanoid that has formula C11H14O2. |
|
| has functional parent | ||
| label |
O-methyleugenol |
|
| prefixIRI |
CHEBI:4918 |
|
| prefLabel |
O-methyleugenol |
|
| subClassOf |
Create mapping
| Delete | Mapping To | Ontology | Source |
|---|---|---|---|
| http://purl.obolibrary.org/obo/CHEBI_4918 | CHEBI | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_4918 | EFO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_4918 | CHEBI | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_4918 | BERO | SAME_URI | |
| http://purl.obolibrary.org/obo/CHEBI_4918 | CHEBI | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_4918 | EFO | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_4918 | CHEBI | LOOM | |
| http://purl.obolibrary.org/obo/CHEBI_4918 | BERO | LOOM |