loading...| Preferred Name |
didanosine |
|
| Synonyms |
|
|
| Definitions |
A purine 2',3'-dideoxyribonucleoside that is inosine in which the hydroxy groups at both the 2' and the 3' positions on the sugar moiety have been replaced by hydrogen. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_490877 |
|
| alternative term |
InChI=1S/C10H12N4O3/c15-3-6-1-2-7(17-6)14-5-13-8-9(14)11-4-12-10(8)16/h4-7,15H,1-3H2,(H,11,12,16)/t6-,7+/m0/s1 9-((2R,5S)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-1,9-dihydro-purin-6-one 2',3'-dideoxyinosine didanosinum OC[C@@H]1CC[C@@H](O1)n1cnc2c1nc[nH]c2=O dideoxyinosine ddIno didanosine Didanosine didanosina DDI 9-((2R,5S)-5-(hydroxymethyl)-tetrahydrofuran-2-yl)-1H-purin-6(9H)-one 9-((2S,5R)-5-Hydroxymethyl-tetrahydro-furan-2-yl)-9H-purin-6-ol InChIKey=BXZVVICBKDXVGW-NKWVEPMBSA-N 2,3-dideoxyinosine C10H12N4O3 9-[(2R,5S)-5-(hydroxymethyl)tetrahydrofuran-2-yl]-1,9-dihydro-6H-purin-6-one ddI |
|
| definition |
A purine 2',3'-dideoxyribonucleoside that is inosine in which the hydroxy groups at both the 2' and the 3' positions on the sugar moiety have been replaced by hydrogen. |
|
| has role |
http://purl.obolibrary.org/obo/CHEBI_53756 |
|
| label |
didanosine |
|
| prefixIRI |
CHEBI:490877 |
|
| prefLabel |
didanosine |
|
| subClassOf |