loading...| Preferred Name |
clavulanic acid |
|
| Synonyms |
|
|
| Definitions |
Antibiotic isolated from Streptomyces clavuligerus. It acts as a suicide inhibitor of bacterial beta-lactamase enzymes. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_48947 |
|
| alternative term |
(Z)-(2R,5R)-3-(2-Hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo(3.2.0)heptane-2-carboxylic acid acidum clavulanicum acido clavulanico (2R,3Z,5R)-3-(2-HYDROXYETHYLIDENE)-7-OXO-4-OXA-1-AZABICYCLO[3.2.0]HEPTANE-2-CARBOXYLIC ACID Clavulansaeure MM 14151 InChIKey=HZZVJAQRINQKSD-PBFISZAISA-N antibiotic MM 14151 clavulanic acid acide clavulanique InChI=1S/C8H9NO5/c10-2-1-4-7(8(12)13)9-5(11)3-6(9)14-4/h1,6-7,10H,2-3H2,(H,12,13)/b4-1-/t6-,7-/m1/s1 Clavulanate (2R,3Z,5R)-3-(2-hydroxyethylidene)-7-oxo-4-oxa-1-azabicyclo[3.2.0]heptane-2-carboxylic acid C8H9NO5 Clavulanic acid [H][C@@]12CC(=O)N1[C@@H](C(O)=O)C(O2)=CCO |
|
| definition |
Antibiotic isolated from Streptomyces clavuligerus. It acts as a suicide inhibitor of bacterial beta-lactamase enzymes. |
|
| has role | ||
| is conjugate acid of | ||
| label |
clavulanic acid |
|
| prefixIRI |
CHEBI:48947 |
|
| prefLabel |
clavulanic acid |
|
| subClassOf |