Preferred Name |
ethacrynic acid |
|
Synonyms |
|
|
Definitions |
An aromatic ether that has formula C13H12Cl2O4. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4876 |
|
alternative term |
Uregit Methylenebutyrylphenoxyacetic acid InChI=1S/C13H12Cl2O4/c1-3-7(2)13(18)8-4-5-9(12(15)11(8)14)19-6-10(16)17/h4-5H,2-3,6H2,1H3,(H,16,17) Hydromedin Edecrina Etacrinic acid C13H12Cl2O4 acido etacrinico Edecril Crinuryl etacrynic acid Endecril [2,3-dichloro-4-(2-methylidenebutanoyl)phenoxy]acetic acid Otacril Hidromedin Taladren InChIKey=AVOLMBLBETYQHX-UHFFFAOYSA-N acidum etacrynicum acide etacrynique (2,3-Dichloro-4-(2-methylene-1-oxobutyl)phenoxy)acetic acid Ethacrynate CCC(=C)C(=O)c1ccc(OCC(O)=O)c(Cl)c1Cl Reomax Mingit |
|
definition |
An aromatic ether that has formula C13H12Cl2O4. |
|
has functional parent | ||
has role | ||
label |
ethacrynic acid |
|
prefixIRI |
CHEBI:4876 |
|
prefLabel |
ethacrynic acid |
|
subClassOf |
Create mapping