Jump to:
loading...| Preferred Name |
amylmetacresol |
|
| Synonyms |
|
|
| Definitions |
A phenol having the structure of m-cresol substituted at the 6-position with an amyl group. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_48213 |
|
| alternative term |
CCCCCc1ccc(C)cc1O 6-n-pentyl-m-cresol Amylmetacresol 6-pentyl-m-cresol C12H18O InChIKey=CKGWFZQGEQJZIL-UHFFFAOYSA-N InChI=1S/C12H18O/c1-3-4-5-6-11-8-7-10(2)9-12(11)13/h7-9,13H,3-6H2,1-2H3 6-n-amyl-m-cresol 5-methyl-2-pentylphenol 6-amyl-m-cresol amylmetacresolum |
|
| definition |
A phenol having the structure of m-cresol substituted at the 6-position with an amyl group. |
|
| has functional parent | ||
| has role | ||
| label |
amylmetacresol |
|
| prefixIRI |
CHEBI:48213 |
|
| prefLabel |
amylmetacresol |
|
| subClassOf |
Create mapping