Jump to:
loading...| Preferred Name |
2-aminopurine |
|
| Synonyms |
|
|
| Definitions |
The parent compound of the 2-aminopurines, comprising a purine core carrying an amino substituent at the 2-position. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_479072 |
|
| alternative term |
Nc1ncc2nc[nH]c2n1 2'-amino-purine InChIKey=MWBWWFOAEOYUST-UHFFFAOYSA-N InChI=1S/C5H5N5/c6-5-7-1-3-4(10-5)9-2-8-3/h1-2H,(H3,6,7,8,9,10) C5H5N5 9H-purin-2-amine 1H-purin-2-amine 2-amino purine |
|
| definition |
The parent compound of the 2-aminopurines, comprising a purine core carrying an amino substituent at the 2-position. |
|
| has role | ||
| label |
2-aminopurine |
|
| prefixIRI |
CHEBI:479072 |
|
| prefLabel |
2-aminopurine |
|
| subClassOf |
Create mapping