Preferred Name |
ellagic acid |
|
Synonyms |
|
|
Definitions |
A cyclic ketone that has formula C14H6O8. |
|
ID |
http://purl.obolibrary.org/obo/CHEBI_4775 |
|
alternative term |
2,3,7,8-tetrahydroxychromeno[5,4,3-cde]chromene-5,10-dione InChI=1S/C14H6O8/c15-5-1-3-7-8-4(14(20)22-11(7)9(5)17)2-6(16)10(18)12(8)21-13(3)19/h1-2,15-18H 2,3,7,8-tetrahydroxy[1]benzopyrano[5,4,3-cde][1]benzopyran-5,10-dione 4,4',5,5',6,6'-hexahydroxydiphenic acid 2,6,2',6'-dilactone Ellagsaeure Lagistase C14H6O8 Oc1cc2c3c(oc(=O)c4cc(O)c(O)c(oc2=O)c34)c1O Ellagic acid benzoaric acid InChIKey=AFSDNFLWKVMVRB-UHFFFAOYSA-N |
|
definition |
A cyclic ketone that has formula C14H6O8. |
|
label |
ellagic acid |
|
prefixIRI |
CHEBI:4775 |
|
prefLabel |
ellagic acid |
|
subClassOf |
Create mapping