Jump to:
loading...| Preferred Name |
chlordiazepoxide hydrochloride |
|
| Synonyms |
|
|
| Definitions |
A hydrochloride that has formula C16H14ClN3O.HCl. |
|
| ID |
http://purl.obolibrary.org/obo/CHEBI_3612 |
|
| alternative term |
Elenium C16H14ClN3O.HCl chlordiazepoxide monohydrochloride Viansin Lentotran InChIKey=DMLFJMQTNDSRFU-UHFFFAOYSA-N Benzodiapin InChI=1S/C16H14ClN3O.ClH/c1-18-15-10-20(21)16(11-5-3-2-4-6-11)13-9-12(17)7-8-14(13)19-15;/h2-9H,10H2,1H3,(H,18,19);1H Cebrum Seren Vita A-Poxide Psichial Cl.CNC1=Nc2ccc(Cl)cc2C(c2ccccc2)=N(=O)C1 7-chloro-N-methyl-5-phenyl-3H-1,4-benzodiazepin-2-amine 4-oxide hydrochloride Reliberan C16H15Cl2N3O Librium Balance Ansiacal Labican Equibral |
|
| definition |
A hydrochloride that has formula C16H14ClN3O.HCl. |
|
| has part | ||
| has role | ||
| label |
chlordiazepoxide hydrochloride |
|
| prefixIRI |
CHEBI:3612 |
|
| prefLabel |
chlordiazepoxide hydrochloride |
|
| subClassOf |
Create mapping